CAS 15499-91-9
:1,3-bis[(carbamoylamino)methyl]urea (non-preferred name)
Description:
1,3-bis[(carbamoylamino)methyl]urea, also known by its non-preferred name, is a chemical compound characterized by its dual carbamoylamino functional groups attached to a urea backbone. This structure imparts unique properties, including potential solubility in polar solvents due to the presence of amide groups, which can engage in hydrogen bonding. The compound is typically white to off-white in appearance and may exhibit moderate stability under standard conditions. Its molecular structure suggests it could participate in various chemical reactions, particularly those involving nucleophilic attack or coordination with metal ions. Additionally, due to its functional groups, it may have applications in agricultural chemistry, particularly as a potential fertilizer or growth regulator, as well as in pharmaceuticals for its possible bioactivity. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,3-bis[(carbamoylamino)methyl]urea represents a compound of interest in both research and practical applications.
Formula:C5H12N6O3
InChI:InChI=1/C5H12N6O3/c6-3(12)8-1-10-5(14)11-2-9-4(7)13/h1-2H2,(H3,6,8,12)(H3,7,9,13)(H2,10,11,14)
InChI key:InChIKey=OKNSZPQWMKXIEO-UHFFFAOYSA-N
SMILES:C(NC(=N)O)N=C(NCNC(=N)O)O
Synonyms:- 1,3-Bis[(carbamoylamino)methyl]urea
- 2,4,6,8-Tetraazanonanediamide, 5-oxo-
- 5-Oxo-2,4,6,8-tetraazanonanediamide
- Dimethylenetriurea
- Urea, 1,3-bis(ureidomethyl)-
- urea, N,N''-[carbonylbis(iminomethylene)]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Dimethylenetriurea
CAS:Controlled Product<p>Applications Dimethylenetriurea is a urea-formaldehyde slow release nitrogen fertilizer. A urea-aldehyde condensation product with multiple industrial applications.<br>References Guo, Y., et al.: Sci. Rep., 8, 1 (2018); Yang, Z., et al.: Polym. Degrad. Stabil., 128, 107 (2016); Jahns, T., et al.: J. Polym. Environ., 11, 155 (2003)<br></p>Formula:C5H12N6O3Color and Shape:NeatMolecular weight:204.187

