CAS 155111-88-9
:hynapene B
Description:
Hynapene B, with the CAS number 155111-88-9, is a chemical compound that belongs to the class of natural products known as alkaloids. It is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Hynapene B is primarily derived from certain plant sources and has been studied for its potential pharmacological properties, including anti-inflammatory and analgesic effects. The compound exhibits moderate solubility in organic solvents, which is common for many alkaloids, and its stability can be influenced by environmental factors such as pH and temperature. Research into hynapene B is ongoing, focusing on its mechanisms of action and potential therapeutic applications. As with many natural products, the extraction and purification processes are crucial for obtaining the compound in a usable form for further study. Overall, hynapene B represents a fascinating area of study within the field of medicinal chemistry and natural product research.
Formula:C18H24O3
InChI:InChI=1/C18H24O3/c1-11-8-12(2)18-14(9-11)10-16(19)13(3)15(18)6-4-5-7-17(20)21/h4-7,11-12,14,18H,8-10H2,1-3H3,(H,20,21)/b6-4+,7-5+
Synonyms:- 2,4-Pentadienoic acid, 5-(3,4,4a,5,6,7,8,8a-octahydro-2,6,8-trimethyl-3-oxo-1-naphthalenyl)- (9CI)
- hynapene B
- (2E,4E)-5-(2,6,8-trimethyl-3-oxo-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)penta-2,4-dienoic acid
- 2,4-Pentadienoic acid, 5-(3,4,4a,5,6,7,8,8a-octahydro-2,6,8-trimethyl-3-oxo-1-naphthalenyl)-
- 5-(1-Ene-3-oxo-2,6,8-trimethyldecalin)-2,4-pentadienoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hynapene B
CAS:<p>Hynapene B exhibits an inhibitory minimum inhibitory concentration (MIC) of 34.7 μM against Eimeria tenella.</p>Formula:C18H24O3Color and Shape:SolidMolecular weight:288.381
