CAS 15513-87-8

Iodic acid (HIO3), lutetium(3+) salt

Description:

Iodic acid (HIO3) is a strong oxidizing agent and a moderately strong acid, characterized by its ability to release iodine species in solution. When combined with lutetium(3+) ions, it forms a salt that typically exhibits properties associated with both the iodate and the lutetium ion. Lutetium, a lanthanide element, is known for its high density and relatively high melting point, contributing to the stability of the resulting compound. The lutetium(3+) salt of iodic acid may display unique solubility characteristics, depending on the specific counterion interactions and the overall lattice structure. In aqueous solutions, the compound can participate in redox reactions, influenced by the presence of iodate ions. Additionally, the compound may exhibit specific optical properties due to the presence of lutetium, which can be relevant in various applications, including materials science and catalysis. Safety considerations should be taken into account, as both iodic acid and lutetium salts can pose health risks if not handled properly.

Formula: HIO₃Lu

InChI: InChI=1S/HIO3.Lu/c2-1(3)4;/h(H,2,3,4);

InChI key: InChIKey=OMYNSEIKQKBODO-UHFFFAOYSA-N

SMILES: I(=O)(=O)O.[Lu]

Synonyms:

• Lutetium iodate (Lu(IO3)3)
• Iodic acid (HIO3), lutetium(3+) salt
• Lutetium(3+) iodate
• Lutetium triiodate