CAS 155155-73-0
:(2R,5R)-2,5-DIPHENYLPYRROLIDINE
Description:
(2R,5R)-2,5-Diphenylpyrrolidine is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered cyclic amine. The presence of two phenyl groups attached to the second and fifth carbon atoms of the pyrrolidine structure contributes to its unique properties, including increased steric hindrance and potential for specific interactions in biological systems. This compound is of interest in medicinal chemistry and drug development due to its potential as a scaffold for designing pharmaceuticals. Its chirality, indicated by the (2R,5R) configuration, suggests that it may exhibit different biological activities compared to its enantiomers. The compound's solubility, stability, and reactivity can vary based on the functional groups and the overall molecular structure. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis. Overall, (2R,5R)-2,5-Diphenylpyrrolidine is a significant compound in the study of stereochemistry and its implications in drug design and development.
Formula:C16H17N
InChI:InChI=1/C16H17N/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-10,15-17H,11-12H2/t15-,16-/m1/s1
SMILES:c1ccc(cc1)[C@H]1CC[C@H](c2ccccc2)N1
Synonyms:- (2R,5R)-Diphenylpyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,5R)-2,5-Diphenylpyrrolidine
CAS:Formula:C16H17NPurity:>95.0%(GC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:223.32Pyrrolidine, 2,5-diphenyl-, (2R,5R)-
CAS:Formula:C16H17NPurity:95%Color and Shape:SolidMolecular weight:223.3129(2R,5R)-2,5-Diphenylpyrrolidine
CAS:Purity:98%Color and Shape:SolidMolecular weight:223.31900024414062(2R,5R)-2,5-Diphenylpyrrolidine
CAS:2,5-Diphenylpyrrolidine is an enantiopure compound that has been shown to be a useful intermediate in the synthesis of imines. The proton on the carbon adjacent to the nitrogen is labile and can be displaced by other nucleophiles. 2,5-Diphenylpyrrolidine reacts with amines to form N-substituted morpholines. This reaction is selective for primary amines over secondary amines and tertiary amines. It also has been used in the preparation of metallacycles as well as organometallic compounds.Formula:C16H17NPurity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:223.31 g/mol




