CymitQuimica logo

CAS 155172-12-6

:

Mirtazapine N-Oxide

Description:
Mirtazapine N-Oxide is a chemical compound derived from mirtazapine, an antidepressant primarily used to treat major depressive disorder. It is characterized by its unique molecular structure, which includes a piperazino group and an oxazepine ring. The N-oxide designation indicates that one of the nitrogen atoms in the piperazine moiety has been oxidized, which can influence the compound's pharmacological properties and metabolic pathways. Mirtazapine N-Oxide is typically studied for its potential effects on neurotransmitter systems, particularly serotonin and norepinephrine, which are crucial in mood regulation. The compound may exhibit different bioactivity compared to its parent drug, and its solubility, stability, and interaction with biological targets can vary. As with many pharmaceutical compounds, understanding its characteristics is essential for evaluating its therapeutic potential and safety profile. Research into Mirtazapine N-Oxide continues to explore its role in pharmacology and its implications in clinical settings.
Formula:C17H19N3O
InChI:InChI=1S/C17H19N3O/c1-20(21)10-9-19-16(12-20)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)19/h2-8,16H,9-12H2,1H3
InChI key:GAFCUVMEBFTFQJ-UHFFFAOYSA-N
SMILES:C[N+]1(CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4)[O-]
Synonyms:
  • 1,2,3,4,10,14b-Hexahydro-2-methyl-pyrazino[2,1-α]pyrido[2,3-c][2]benzazepine 2-Oxide
Found 10 products.