
CAS 155179-21-8
:Vanicoside B
Description:
Vanicoside B, with the CAS number 155179-21-8, is a natural compound classified as a glycoside. It is primarily derived from certain plant species, particularly those in the genus *Vinca*. This compound is known for its potential biological activities, including antioxidant and anti-inflammatory properties. Vanicoside B exhibits a complex structure that includes a sugar moiety linked to a phenolic aglycone, which contributes to its pharmacological effects. The compound has garnered interest in medicinal chemistry due to its potential therapeutic applications, particularly in the context of cancer research and treatment. Its solubility characteristics may vary depending on the solvent used, which is an important consideration for its application in biological systems. Additionally, Vanicoside B's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, ongoing research aims to further elucidate its mechanisms of action and potential uses in pharmaceuticals and nutraceuticals.
Formula:C49H48O20
InChI:InChI=1S/C49H48O20/c1-62-36-24-31(8-19-35(36)53)12-22-40(55)63-25-37-43(58)45(60)46(61)48(66-37)69-49(27-65-41(56)21-10-29-4-15-33(51)16-5-29)47(67-42(57)23-11-30-6-17-34(52)18-7-30)44(59)38(68-49)26-64-39(54)20-9-28-2-13-32(50)14-3-28/h2-24,37-38,43-48,50-53,58-61H,25-27H2,1H3/b20-9+,21-10+,22-12+,23-11+/t37-,38-,43-,44-,45+,46-,47+,48-,49+/m1/s1
InChI key:InChIKey=ALSDWGAQQGXOHC-PWYSLETCSA-N
SMILES:O([C@@]1(COC(/C=C/C2=CC=C(O)C=C2)=O)[C@@H](OC(/C=C/C3=CC=C(O)C=C3)=O)[C@H](O)[C@@H](COC(/C=C/C4=CC=C(O)C=C4)=O)O1)[C@H]5O[C@H](COC(/C=C/C6=CC(OC)=C(O)C=C6)=O)[C@@H](O)[C@H](O)[C@H]5O
Synonyms:- α-D-Glucopyranoside, 1,3,6-tris-O-[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]-β-D-fructofuranosyl, 6-[3-(4-hydroxy-3-methoxyphenyl)-2-propenoate], [1[1(E),3(E),6(E)],6(E)]-
- α-D-Glucopyranoside, 1,3,6-tris-O-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]-β-D-fructofuranosyl, 6-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
- Vanicoside B
- α-D-Glucopyranoside, 1,3,6-tris-O-[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]-β-D-fructofuranosyl, 6-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Vanicoside B
CAS:Vanicoside B is a natural product for research related to life sciences. The catalog number is TN6220 and the CAS number is 155179-21-8.
Formula:C49H48O20Purity:98%Color and Shape:SolidMolecular weight:956.903Vanicoside B
CAS:Vanicoside B is a polyphenolic compound, which is a natural product derived from the plant Polygonum cuspidatum. It functions primarily as an anti-inflammatory agent, exerting its effects through the inhibition of key inflammatory pathways, including those mediated by cyclooxygenase and lipoxygenase enzymes. These pathways are pivotal in the synthesis of pro-inflammatory mediators, and their inhibition by Vanicoside B contributes to its therapeutic potential.Formula:C49H48O20Purity:Min. 95%Molecular weight:956.9 g/mol


