CAS 15519-73-0: 5,5'-dimethylbiphenyl-2,2'-diol

Description:5,5'-Dimethylbiphenyl-2,2'-diol, with the CAS number 15519-73-0, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two hydroxyl (-OH) groups at the 2 and 2' positions of the biphenyl framework indicates that it is a diol, specifically a catechol derivative. The two methyl groups at the 5 and 5' positions contribute to its hydrophobic character and influence its solubility in organic solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its hydroxyl groups can participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. 5,5'-Dimethylbiphenyl-2,2'-diol may find applications in organic synthesis, as a building block in the production of more complex molecules, or in materials science due to its potential role in modifying polymer properties. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula:C₁₄H₁₄O₂

InChI:InChI=1/C14H14O2/c1-9-3-5-13(15)11(7-9)12-8-10(2)4-6-14(12)16/h3-8,15-16H,1-2H3