CAS 15524-47-7

6,7-Dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile

Description:

6,7-Dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile, with the CAS number 15524-47-7, is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyridine ring fused to a cyclopentane ring. This compound features a carbonitrile functional group (-C≡N) at the 4-position of the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonitrile group often imparts polar characteristics, influencing solubility and interaction with other chemical species. The bicyclic nature of the compound can lead to unique electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which warrants investigation for potential pharmaceutical applications. Its synthesis typically involves multi-step organic reactions, and it may serve as an intermediate in the production of more complex molecules. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions.

Formula: C₉H₈N₂

InChI: InChI=1S/C9H8N2/c10-4-8-6-11-5-7-2-1-3-9(7)8/h5-6H,1-3H2

InChI key: InChIKey=PUSDCJBEIWPQRN-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(CCC2)=CN=C1

Synonyms:

• 6,7-Dihydro-5H-cyclopenta[c]pyridine-4-carbonitrile
• 5H-2-Pyrindine-4-carbonitrile, 6,7-dihydro-
• 5H-Cyclopenta[c]pyridine-4-carbonitrile, 6,7-dihydro-

5H,6H,7H-Cyclopenta[C]pyridine-4-carbonitrile

CAS: 15524-47-7

Versatile small molecule scaffold

Formula: C₉H₈N₂

Purity: Min. 95%

Molecular weight: 144.17 g/mol

Ref: 3D-QAA52447