CAS 155258-22-3
:2-(Tributylstannyl)-2-propen-1-amine
Description:
2-(Tributylstannyl)-2-propen-1-amine, with the CAS number 155258-22-3, is an organotin compound characterized by the presence of a tributylstannyl group attached to a propenamine structure. This compound typically exhibits a clear to yellowish liquid form and is known for its reactivity due to the presence of the propenamine functional group, which can participate in various chemical reactions, including polymerization and cross-linking processes. The tributylstannyl moiety contributes to its unique properties, such as enhanced solubility in organic solvents and potential applications in organometallic chemistry. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. However, due to the toxicity associated with organotin compounds, safety precautions are essential when handling this substance. Overall, 2-(Tributylstannyl)-2-propen-1-amine serves as a versatile intermediate in synthetic chemistry, particularly in the development of novel materials and chemical processes.
Formula:C15H33NSn
InChI:InChI=1/3C4H9.C3H6N.Sn/c3*1-3-4-2;1-2-3-4;/h3*1,3-4H2,2H3;1,3-4H2;/rC15H33NSn/c1-5-8-11-17(12-9-6-2,13-10-7-3)15(4)14-16/h4-14,16H2,1-3H3
SMILES:CCCC[Sn](CCCC)(CCCC)C(=C)CN
Synonyms:- 2-(Tributylstannanyl)Prop-2-En-1-Amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Tributylstannyl)-2-propen-1-amine
CAS:Formula:C15H33NSnColor and Shape:LiquidMolecular weight:346.13022-(Tributylstannyl)-2-propen-1-amine
CAS:Controlled ProductApplications 2-(Tributylstannyl)-2-propen-1-amine (cas# 155258-22-3) is a compound useful in organic synthesis.
Formula:C15H33NSnColor and Shape:NeatMolecular weight:346.142-(Tributylstannyl)-2-propen-1-amine
CAS:Controlled Product2-(Tributylstannyl)-2-propen-1-amine is a palladium-catalyzed cross-coupling agent that has been used to synthesize amines from alcohols. It is also used in the synthesis of other organic compounds, such as pyridines and related heterocycles. 2-(Tributylstannyl)-2-propen-1-amine can be prepared by reacting tributyltin chloride with an amine in the presence of hydrochloric acid, which protonates the amine. This reaction product is then reacted with an alkyl halide in the presence of a base to form a new carbon-carbon bond. The optical properties of this compound are determined by its ligands and substituents on the pyridine ring. Reaction products include tributyltin chloride, which is not toxic but may be carcinogenic and teratogenic, and bis(tributylstannFormula:C15H33NSnPurity:Min. 95%Molecular weight:346.1 g/mol


