CymitQuimica logo

CAS 155266-68-5

:

Benzene, 4-[4'-(3-butenyl)[1,1'-bicyclohexyl]-4-yl]-1,2-difluoro-, [trans(trans)]-

Description:
Benzene, 4-[4'-(3-butenyl)[1,1'-bicyclohexyl]-4-yl]-1,2-difluoro-, commonly referred to by its CAS number 155266-68-5, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a difluoro group and a bicyclohexyl moiety. The presence of the 3-butenyl group introduces unsaturation, which can influence the compound's reactivity and physical properties. The difluoro substituents enhance the compound's polarity and may affect its solubility in various solvents. This compound is likely to exhibit hydrophobic characteristics due to the aromatic and bicyclic structures, making it less soluble in water but more soluble in organic solvents. Additionally, the stereochemistry indicated by the "[trans(trans)]" notation suggests specific spatial arrangements of the substituents, which can impact the compound's interactions and potential applications in fields such as materials science or pharmaceuticals. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications.
Formula:C22H30F2
InChI:InChI=1S/C22H30F2/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)20-13-14-21(23)22(24)15-20/h2,13-19H,1,3-12H2
InChI key:UMULWEQZNFZORL-UHFFFAOYSA-N
SMILES:C=CCCC1CCC(CC1)C2CCC(CC2)C3=CC(=C(C=C3)F)F
Synonyms:
  • Trans,Trans-4-But-3-Enyl-4'-(3,4-Difluoro-Phenyl)-Bicyclohexyl
Found 4 products.