
CAS 155271-17-3
:8-[(E)-2-(2,3-Dimethyl-4-methoxyphenyl)vinyl]-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
Description:
The chemical substance known as "8-[(E)-2-(2,3-Dimethyl-4-methoxyphenyl)vinyl]-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione," with the CAS number 155271-17-3, is a purine derivative characterized by its complex structure that includes a purine core and a vinyl-substituted aromatic moiety. This compound features multiple methyl and methoxy groups, contributing to its lipophilicity and potential biological activity. The presence of the vinyl group suggests that it may participate in various chemical reactions, including polymerization or conjugation with other molecules. Its structural features indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's unique arrangement of functional groups may influence its solubility, stability, and interaction with biological targets, making it a subject of interest for further research in drug design and development. Overall, this substance exemplifies the intricate relationship between molecular structure and biological function in the realm of organic chemistry.
Formula:C19H22N4O3
InChI:InChI=1/C19H22N4O3/c1-11-12(2)14(26-6)9-7-13(11)8-10-15-20-17-16(21(15)3)18(24)23(5)19(25)22(17)4/h7-10H,1-6H3/b10-8+
Synonyms:- Kf-21213
- 8-[(E)-2-(4-methoxy-2,3-dimethylphenyl)ethenyl]-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Purine-2,6-dione, 3,7-dihydro-8-[(1E)-2-(4-methoxy-2,3-dimethylphenyl)ethenyl]-1,3,7-trimethyl-
CAS:Formula:C19H22N4O3Molecular weight:354.403KF21213
CAS:KF21213 is a peptide that binds to the extracellular domain of the human histamine H3 receptor. KF21213 has been shown to inhibit the binding of histamine to its receptor, leading to reduced histamine-mediated signaling. The peptide also interacts with other receptors, such as muscarinic acetylcholine receptors, and ion channels, such as potassium channels. This tool is used in research for studying various aspects of cell biology and pharmacology.Formula:C19H22N4O3Purity:Min. 95%Molecular weight:354.4 g/molKF21213
CAS:KF21213 shows a high affinity for the adenosine A2A receptors (Ki=3.0 nM). KF21213 is a highly selective ligand for mapping CNS adenosine A2A receptors.Formula:C19H22N4O3Purity:98%Color and Shape:SolidMolecular weight:354.4


