
CAS 15534-05-1
:4-[1-Hydroxy-2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-1,2-benzenediol
Description:
4-[1-Hydroxy-2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-1,2-benzenediol, with CAS number 15534-05-1, is a chemical compound that belongs to the class of phenolic compounds. It features a complex structure characterized by a benzene ring substituted with hydroxyl groups and a piperazine moiety, which contributes to its potential biological activity. The presence of the methoxyphenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit various biological activities, including potential effects on the central nervous system, due to the piperazine structure, which is often associated with psychoactive properties. Its solubility and stability can be influenced by the hydroxyl groups, making it a subject of interest in medicinal chemistry. As with many organic compounds, its reactivity may vary depending on environmental conditions, and it may participate in various chemical reactions typical of phenolic compounds, such as oxidation or esterification. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.
Formula:C19H24N2O4
InChI:InChI=1S/C19H24N2O4/c1-25-19-5-3-2-4-15(19)21-10-8-20(9-11-21)13-18(24)14-6-7-16(22)17(23)12-14/h2-7,12,18,22-24H,8-11,13H2,1H3
InChI key:InChIKey=QESTYTNSJJTQCI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)N2CCN(CC(O)C3=CC(O)=C(O)C=C3)CC2
Synonyms:- S 4216
- Pipratecol
- 1,2-Benzenediol, 4-[1-hydroxy-2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-
- 1-Piperazineethanol, α-(3,4-dihydroxyphenyl)-4-(o-methoxyphenyl)-
- 4-[1-Hydroxy-2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]-1,2-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pipratecol
CAS:Pipratecol can affect platelet aggregation and the platelet release reaction.Formula:C19H24N2O4Color and Shape:SolidMolecular weight:344.4
