CAS 15536-54-6
:Tetrathionate
Description:
Tetrathionate, with the chemical formula S4O6^2−, is an oxyanion of sulfur characterized by its unique structure, which consists of four sulfur atoms and six oxygen atoms. It is commonly encountered in the form of its sodium salt, sodium tetrathionate, which is often used in various chemical applications, including as a reagent in analytical chemistry and in microbiological studies. Tetrathionate is known for its role in the sulfur cycle, particularly in the oxidation of sulfide minerals and in certain biochemical processes involving sulfur-oxidizing bacteria. The compound exhibits properties typical of thionates, such as being a reducing agent under specific conditions. Tetrathionate can be formed through the oxidation of thiosulfate and is often studied for its potential applications in environmental chemistry and biochemistry. Its stability and reactivity can vary depending on the pH and the presence of other chemical species, making it an interesting subject for research in both inorganic and environmental chemistry.
Formula:O6S4
InChI:InChI=1S/H2O6S4/c1-9(2,3)7-8-10(4,5)6/h(H,1,2,3)(H,4,5,6)/p-2
InChI key:InChIKey=HPQYKCJIWQFJMS-UHFFFAOYSA-L
SMILES:S(SS(=O)(=O)[O-])S(=O)(=O)[O-]
Synonyms:- Tetrathionate
- Tetrathionate (S4O62-)
- Tetrathionate ion(2-)
- Tetrathionate ion
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
