CymitQuimica logo

CAS 155369-11-2

:

3-(fmoc-aminomethyl)benzoic acid

Description:
3-(Fmoc-aminomethyl)benzoic acid is a chemical compound characterized by the presence of a benzoic acid moiety substituted with an aminomethyl group and a fluorenylmethyloxycarbonyl (Fmoc) protective group. The Fmoc group is commonly used in peptide synthesis as a protective group for amines, allowing for selective reactions without interfering with other functional groups. This compound typically exhibits properties such as solubility in organic solvents and moderate solubility in water, depending on the pH of the solution. It has a molecular structure that contributes to its potential applications in organic synthesis, particularly in the field of medicinal chemistry and peptide synthesis. The presence of both the carboxylic acid and the amine functional groups allows for various chemical reactions, including coupling reactions, which are essential in the formation of peptide bonds. Additionally, the compound may exhibit specific reactivity patterns due to the steric and electronic effects of the Fmoc group, making it a valuable intermediate in the synthesis of more complex molecules.
Formula:C5H5FN2
InChI:InChI=1/C5H5FN2/c6-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8)
InChI key:VODSFAVGEJUBHO-UHFFFAOYSA-N
SMILES:c1cc(c(N)nc1)F
Synonyms:
  • 3-Fluoropyridin-2-Amine
  • Fmoc-3-Aminomethylbenzoic Acid
Found 5 products.