CymitQuimica logo

CAS 155370-03-9

:

2-(4-fluorophenyl)-2,3-dihydro-1H-quinolin-4-one

Description:
2-(4-Fluorophenyl)-2,3-dihydro-1H-quinolin-4-one is a chemical compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. This compound typically exhibits a solid-state form at room temperature and may be soluble in organic solvents, depending on its specific functional groups and molecular interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the quinoline moiety's known biological activities, including antimicrobial and anticancer properties. The compound's reactivity can be influenced by the presence of the fluorine substituent, which can enhance lipophilicity and affect binding interactions with biological targets. Overall, 2-(4-fluorophenyl)-2,3-dihydro-1H-quinolin-4-one represents a class of compounds that may be of interest in drug discovery and development.
Formula:C15H12FNO
InChI:InChI=1/C15H12FNO/c16-11-7-5-10(6-8-11)14-9-15(18)12-3-1-2-4-13(12)17-14/h1-8,14,17H,9H2
InChI key:HQCCOFMBOJBRQY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C(=O)CC(c1ccc(cc1)F)N2
Synonyms:
  • 2-(4-Fluorophenyl)-2,3-dihydroquinolin-4(1H)-one
  • 4(1H)-quinolinone, 2-(4-fluorophenyl)-2,3-dihydro-
Found 4 products.