CAS 15540-90-6

4,7-Dimethylisatin

Description:

4,7-Dimethylisatin is an organic compound belonging to the isatin family, characterized by its indole structure with two methyl groups attached at the 4 and 7 positions of the isatin ring. It typically appears as a solid, often exhibiting a yellow to orange color. This compound is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. Its molecular formula reflects a combination of carbon, hydrogen, nitrogen, and oxygen, contributing to its reactivity and interaction with various biological targets. 4,7-Dimethylisatin can undergo various chemical reactions, such as oxidation and substitution, which are significant for its application in synthetic organic chemistry. Additionally, it may exhibit fluorescence, which can be useful in analytical applications. As with many isatin derivatives, the study of 4,7-Dimethylisatin continues to reveal insights into its pharmacological potential and mechanisms of action, highlighting its relevance in drug discovery and development.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-5-3-4-6(2)8-7(5)9(12)10(13)11-8/h3-4H,1-2H3,(H,11,12,13)

SMILES: Cc1ccc(C)c2c1C(=O)C(=O)N2

Synonyms:

• 1H-indole-2,3-dione, 4,7-dimethyl-
• 4,7-dimethyl-1H-indole-2,3-dione

1H-Indole-2,3-dione, 4,7-dimethyl-

CAS: 15540-90-6

Formula: C₁₀H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA001NVZ

4,7-Dimethyl-1H-indole-2,3-dione

CAS: 15540-90-6

4,7-Dimethyl-1H-indole-2,3-dione

Purity: 95%

Molecular weight: 175.18g/mol

Ref: 54-OR948082

4,7-Dimethyl-1H-indole-2,3-dione

CAS: 15540-90-6

Formula: C₁₀H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.187

Ref: 10-F060414