CAS 15540-91-7

2-Amino-3,6-dimethylbenzoicacid

Description:

2-Amino-3,6-dimethylbenzoic acid, with the CAS number 15540-91-7, is an aromatic amino acid derivative characterized by the presence of an amino group and a carboxylic acid functional group attached to a benzene ring that is further substituted with two methyl groups. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the amino group imparts basic properties, while the carboxylic acid group contributes acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-5-3-4-6(2)8(10)7(5)9(11)12/h3-4H,10H2,1-2H3,(H,11,12)

SMILES: Cc1ccc(C)c(c1C(=O)O)N

Synonyms:

• 2-Amino-3,6-Dimethylbenzoic Acid

Benzoic acid, 2-amino-3,6-dimethyl-

CAS: 15540-91-7

Formula: C₉H₁₁NO₂

Purity: 97%

Molecular weight: 165.1891

Ref: IN-DA001NVY

2-Amino-3,6-dimethylbenzoic acid

CAS: 15540-91-7

2-Amino-3,6-dimethylbenzoic acid

Purity: 97%

Molecular weight: 165.19g/mol

Ref: 54-OR1055381

2-Amino-3,6-dimethylbenzoic acid

CAS: 15540-91-7

2-Amino-3,6-dimethylbenzoic acid is an equilibrating agent that has been used to study the interaction and kinetics of hydrogen bonds. It is a white crystalline solid with a molecular weight of 164.2 g/mol and a melting point of 127 °C. The kinetic method has been used to study the equilibration between its two forms: 3,4-dihydroxybenzoic acid (DHB) and 2-hydroxybenzoic acid (HBA). This equilibrium can be described by the equation DHB + HBA ⇌ DHB + HBA, where the equilibrium constant is K = [DHB][HBA]/[DHB][HBA]. The kinetic method was also applied to study the reaction between 2-amino-3,6-dimethylbenzoic acid and methyl derivatives of olefins. In this case, the kinetic method was used to determine

Formula: C₉H₁₁NO₂

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-QAA54091