CAS 155412-73-0
:3-[(dimethylamino)methyl]benzoic acid
Description:
3-[(Dimethylamino)methyl]benzoic acid, with the CAS number 155412-73-0, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a dimethylaminomethyl group at the meta position. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, including potential acidity due to the carboxyl functional group. The dimethylamino group contributes to its basicity and can influence its solubility in various solvents, often enhancing solubility in polar environments. The presence of the aromatic ring may also impart stability and influence the compound's reactivity. In terms of applications, compounds of this nature may be utilized in pharmaceuticals, as intermediates in organic synthesis, or in the development of dyes and pigments. The specific characteristics, such as melting point, boiling point, and spectral properties, can vary based on the purity and specific conditions under which the compound is studied. Overall, 3-[(dimethylamino)methyl]benzoic acid is a versatile compound with potential utility in various chemical applications.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-11(2)7-8-4-3-5-9(6-8)10(12)13/h3-6H,7H2,1-2H3,(H,12,13)
SMILES:CN(C)Cc1cccc(c1)C(=O)O
Synonyms:- Benzoic Acid, 3-[(Dimethylamino)Methyl]-
- 3-[(Dimethylamino)methyl]benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-[(dimethylamino)methyl]-
CAS:Formula:C10H13NO2Purity:97%Color and Shape:SolidMolecular weight:179.21573-[(Dimethylamino)methyl]benzoic acid hydrochloride
CAS:<p>3-[(Dimethylamino)methyl]benzoic acid hydrochloride</p>Purity:95%Molecular weight:215.67665g/mol3-[(Dimethylamino)methyl]benzoic acid hydrochloride
CAS:<p>Please enquire for more information about 3-[(Dimethylamino)methyl]benzoic acid hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol



