CAS 155418-97-6
:4,5-Dihydroblumenol
Description:
4,5-Dihydroblumenol, with the CAS number 155418-97-6, is a chemical compound that belongs to the class of organic compounds known as phenols. It is characterized by its bicyclic structure, which includes a fused ring system that contributes to its unique chemical properties. This compound is typically recognized for its potential applications in various fields, including pharmaceuticals and materials science, due to its interesting biological activities and chemical reactivity. 4,5-Dihydroblumenol may exhibit antioxidant properties and could be involved in various biochemical pathways. Its solubility characteristics can vary depending on the solvent, and it may participate in reactions typical of phenolic compounds, such as oxidation and substitution reactions. The compound's stability, reactivity, and potential toxicity would need to be evaluated in specific contexts, particularly when considering its use in research or industrial applications. As with any chemical substance, proper handling and safety protocols should be observed to mitigate any risks associated with its use.
Formula:C13H22O3
InChI:InChI=1S/C13H22O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-6,9-10,14,16H,7-8H2,1-4H3/b6-5+/t9-,10-,13-/m1/s1
InChI key:InChIKey=IHDJYDVWNNFPHR-CHESLIBASA-N
SMILES:C(=C/[C@@H](C)O)\[C@]1(O)C(C)(C)CC(=O)C[C@H]1C
Synonyms:- Cyclohexanone, 4-hydroxy-4-[(1E,3R)-3-hydroxy-1-buten-1-yl]-3,3,5-trimethyl-, (4S,5R)-
- Cyclohexanone, 4-hydroxy-4-(3-hydroxy-1-butenyl)-3,3,5-trimethyl-, [4S-[4α,4(1E,3S*),5α]]-
- Cyclohexanone, 4-hydroxy-4-[(1E,3R)-3-hydroxy-1-butenyl]-3,3,5-trimethyl-, (4S,5R)-
- (4S,5R)-4-Hydroxy-4-[(1E,3R)-3-hydroxy-1-buten-1-yl]-3,3,5-trimethylcyclohexanone
- 4,5-Dihydroblumenol A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,5-Dihydroblumenol A
CAS:4, 5-Dihydroblumenol shows significant inhibition against HepG2 cells transected with cloned hepatitis B virus DNA.Formula:C13H22O3Purity:98%Color and Shape:SolidMolecular weight:226.314,5-Dihydroblumenol A
CAS:Formula:C13H22O3Purity:95%~99%Color and Shape:PowderMolecular weight:226.3164,5-Dihydroblumenol A
CAS:4,5-Dihydroblumenol A is a naturally occurring compound, classified as an apocarotenoid, which is derived from the oxidative cleavage of carotenoids typically found in various plant species. It is primarily sourced from plant tissues where it serves as a metabolite associated with the carotenoid biosynthesis pathway. The compound's mode of action is believed to involve signaling processes within the plant system, potentially influencing plant growth and development by modulating hormonal pathways or stress responses.
Formula:C13H22O3Purity:Min. 95%Color and Shape:PowderMolecular weight:226.31 g/mol


