CymitQuimica logo

CAS 155503-31-4

:

N-(3-chlorobenzyl)-2-(1H-indol-3-yl)ethanamine

Description:
N-(3-chlorobenzyl)-2-(1H-indol-3-yl)ethanamine, with the CAS number 155503-31-4, is a chemical compound characterized by its complex structure, which includes an indole moiety and a chlorobenzyl group. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential biological activity. The presence of the indole ring suggests possible interactions with biological targets, particularly in the realm of pharmacology, where indole derivatives are often explored for their therapeutic effects. The chlorobenzyl group may influence the compound's lipophilicity and binding affinity, impacting its pharmacokinetic properties. Additionally, the amine functional group can participate in hydrogen bonding, which is crucial for molecular interactions in biological systems. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of new therapeutic agents targeting various diseases. However, specific data regarding its solubility, stability, and reactivity would require further investigation through experimental studies.
Formula:C17H17ClN2
InChI:InChI=1/C17H17ClN2/c18-15-5-3-4-13(10-15)11-19-9-8-14-12-20-17-7-2-1-6-16(14)17/h1-7,10,12,19-20H,8-9,11H2
SMILES:c1ccc2c(c1)c(CCNCc1cccc(c1)Cl)c[nH]2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.