
CAS 15552-06-4
:Nitric acid, ammonium yttrium(3+) salt (5:2:1)
Description:
Nitric acid, ammonium yttrium(3+) salt (5:2:1), with the CAS number 15552-06-4, is a complex inorganic compound that typically consists of yttrium ions coordinated with ammonium and nitrate ions. This substance is characterized by its crystalline structure and is often used in various applications, including materials science and catalysis. The presence of yttrium, a rare earth element, imparts unique optical and electronic properties, making it valuable in the production of phosphors and ceramics. The ammonium component contributes to its solubility in water, facilitating its use in aqueous solutions. Additionally, the nitric acid component indicates that the compound may exhibit acidic properties, which can influence its reactivity and interactions with other substances. Safety considerations are important when handling this compound, as it may pose risks associated with its acidic nature and potential toxicity of the metal ions. Overall, this compound is significant in specialized fields, particularly in the development of advanced materials and technologies.
Formula:H3NHNO3Y
InChI:InChI=1S/HNO3.H3N.Y/c2-1(3)4;;/h(H,2,3,4);1H3;
InChI key:InChIKey=PIBKILZRDWWVAR-UHFFFAOYSA-N
SMILES:N(=O)(=O)O.N.[Y]
Synonyms:- Ammonium pentanitratoyttrate(III)
- Nitric acid, ammonium yttrium(3+) salt (5:2:1)
- Ammonium yttrium nitrate ((NH4)2Y(NO3)5)
- Diammonium pentanitratoyttrate(2-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.