CAS 155535-23-2: 2-CHLORO-PYRIDO[2,3-B]PYRAZINE
Description:2-Chloro-pyrido[2,3-b]pyrazine is a heterocyclic organic compound characterized by its fused ring structure, which incorporates both pyridine and pyrazine moieties. The presence of a chlorine atom at the 2-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular structure allows for diverse interactions, making it of interest in medicinal chemistry and material science. The compound may serve as a building block in the synthesis of pharmaceuticals or agrochemicals, owing to its ability to participate in nucleophilic substitution reactions. Additionally, its unique electronic properties can influence its behavior in biological systems, potentially leading to various biological activities. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 2-chloro-pyrido[2,3-b]pyrazine is a valuable compound in synthetic organic chemistry with potential applications in various fields.
Formula:C7H4ClN3
InChI:InChI=1/C7H4ClN3/c8-6-4-10-7-5(11-6)2-1-3-9-7/h1-4H
- Synonyms:
- 2-Chloropyrido[2,3-b]pyrazine
- Pyrido[2,3-B]Pyrazine, 2-Chloro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Pyrido[2,3-b]pyrazine, 3-chloro- REF: IN-DA001NZ1CAS: 155535-23-2 | 97% | 59.00 €~308.00 € | Mon 07 Apr 25 |
![]() | 3-Chloro-pyrido[2,3-b]pyrazine REF: 54-OR929712CAS: 155535-23-2 | 95% | 133.00 €~946.00 € | Tue 08 Apr 25 |
![]() | 3-Chloropyrido[2,3-b]pyrazine REF: 10-F323936CAS: 155535-23-2 | 95.0% | 104.00 €~1,591.00 € | Tue 08 Apr 25 |
![]() | 3-Chloropyrido[2,3-b]pyrazine REF: 3D-FC141147CAS: 155535-23-2 | Min. 95% | - - - | Discontinued product |

Pyrido[2,3-b]pyrazine, 3-chloro-
Ref: IN-DA001NZ1
1g | 308.00 € | ||
100mg | 59.00 € | ||
250mg | 114.00 € |

Ref: 54-OR929712
1g | 946.00 € | ||
100mg | 133.00 € | ||
250mg | 260.00 € |

3-Chloropyrido[2,3-b]pyrazine
Ref: 10-F323936
1g | 357.00 € | ||
5g | 1,591.00 € | ||
250mg | 104.00 € |

3-Chloropyrido[2,3-b]pyrazine
Ref: 3D-FC141147
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |