CAS 155543-02-5

Lithium tetrakis(pentafluorophenyl)borate - Ethyl ether complex

Description:

Lithium tetrakis(pentafluorophenyl)borate-ethyl ether complex is a coordination compound characterized by its lithium cation coordinated to a tetrakis(pentafluorophenyl)borate anion, which consists of a boron atom bonded to four pentafluorophenyl groups. This compound is notable for its high solubility in organic solvents, particularly ethers, due to the presence of ethyl ether in its complex structure. The pentafluorophenyl groups contribute to the compound's unique electronic properties, making it a strong Lewis acid and enhancing its stability in various chemical environments. Additionally, the presence of fluorine atoms imparts significant electronegativity, which can influence reactivity and interactions with other chemical species. This compound is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the field of organometallic chemistry. Its properties make it valuable for applications in materials science and as a potential electrolyte in lithium-based batteries. Overall, lithium tetrakis(pentafluorophenyl)borate-ethyl ether complex is a versatile and significant compound in advanced chemical research.

Formula: C₂₈H₁₀BF₂₀LiO

InChI: InChI=1/C24BF20.C4H10O.Li/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-3-5-4-2;/h;3-4H2,1-2H3;/q-1;;+1

SMILES: c1(c(c(c(c(c1F)F)F)F)F)[B-](c1c(c(c(c(c1F)F)F)F)F)(c1c(c(c(c(c1F)F)F)F)F)c1c(c(c(c(c1F)F)F)F)F.CCOCC.[Li]

Synonyms:

• Lithium Tetrakis(Pentafluorophenyl)Borate(1-) - 1,1'-Oxydiethane (1:1)

Lithium Tetrakis(pentafluorophenyl)borate - Ethyl Ether Complex

CAS: 155543-02-5

Formula: C₂₄BF₂₀Li·nC₄H₁₀O

Purity: >70.0%(T)

Color and Shape: White to Light yellow to Light orange powder to crystaline

Ref: 3B-L0158

Lithium tetrakis(pentafluorophenyl)borate-ethyl ether complex

CAS: 155543-02-5

Formula: C₂₈H₁₀BF₂₀LiO

Purity: 70%

Color and Shape: Solid

Molecular weight: 760.0985

Ref: IN-DA001O06

Lithium Tetrakis(pentafluorophenyl)borate - Ethyl Ether Complex

Controlled Product

CAS: 155543-02-5

Lithium tetrakis(pentafluorophenyl)borate - ethyl ether complex is a ligand that has the ability to bind to magnesium. The complex is highly soluble in organic solvents such as ethylene and ether, but not in water. It can be used to produce high yields of ethylene with magnesium as a co-catalyst. The complex binds to magnesium by forming a six-membered ring with the borate group and two oxygen atoms from the ether molecule. The crystal structure of this complex was determined using x-ray crystallography. This complex has been found naturally in plants such as spinach and beets, although it is not yet known what role it plays in these plants.

Purity: 70%Nmr

Ref: 3D-FL75664