CAS 155584-74-0
:2-Chloro-3-(4-methyl-1-piperazinyl)quinoxaline
Description:
2-Chloro-3-(4-methyl-1-piperazinyl)quinoxaline is a chemical compound characterized by its quinoxaline core, which is a bicyclic structure containing two nitrogen atoms. The presence of a chlorine atom at the 2-position and a 4-methyl-1-piperazinyl group at the 3-position contributes to its unique properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its moderate polarity. It exhibits biological activity, often studied for its potential as a pharmaceutical agent, particularly in the context of neuropharmacology and as a potential therapeutic for various conditions. The piperazine moiety is known for its ability to interact with neurotransmitter receptors, which may enhance the compound's efficacy in medicinal applications. Additionally, the presence of the chlorine atom can influence the compound's reactivity and stability, making it a subject of interest in synthetic organic chemistry. Overall, 2-Chloro-3-(4-methyl-1-piperazinyl)quinoxaline is a compound of significant interest due to its structural features and potential biological activities.
Formula:C13H15ClN4
InChI:InChI=1S/C13H15ClN4/c1-17-6-8-18(9-7-17)13-12(14)15-10-4-2-3-5-11(10)16-13/h2-5H,6-9H2,1H3
SMILES:CN1CCN(CC1)c1c(Cl)nc2ccccc2n1
Synonyms:- 2-Chloro-3-(4-methylpiperazin-1-yl)quinoxaline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Quinoxaline, 2-chloro-3-(4-methyl-1-piperazinyl)-
CAS:Formula:C13H15ClN4Purity:99%Color and Shape:SolidMolecular weight:262.73802-Chloro-3-(4-Methylpiperazin-1-Yl)Quinoxaline
CAS:<p>2-Chloro-3-(4-Methylpiperazin-1-Yl)Quinoxaline</p>Purity:95%Molecular weight:262.74g/molVUF 10166
CAS:<p>VUF10166 is a novel, potent and competitive antagonist for 5-HT3A receptor with Ki of 0.04 nM, its affinity at 5-HT3AB receptor is significantly lower.</p>Formula:C13H15ClN4Purity:99.66%Color and Shape:SolidMolecular weight:262.742-Chloro-3-(4-methylpiperazin-1-yl)quinoxaline
CAS:Formula:C13H15ClN4Purity:99%Molecular weight:262.74VUF 10166
CAS:<p>VUF 10166 is a selective 5-HT3 receptor antagonist that has been shown to be effective in animal models for the treatment of nausea and vomiting. VUF 10166 binds to the 5-HT3 receptors in the gastrointestinal tract and blocks the activation of these receptors, which are involved in regulating nausea and vomiting. In animal models, VUF 10166 has been shown to have a superior affinity for 5-HT3 receptors, as well as a better selectivity profile than other antagonists currently on the market.</p>Formula:C13H15ClN4Purity:Min. 95%Molecular weight:262.74 g/mol




