CymitQuimica logo

CAS 1556-00-9

:

(2-CHLORO-5-METHYL-PHENOXY)-ACETIC ACID

Description:
(2-Chloro-5-methyl-phenoxy)-acetic acid, with the CAS number 1556-00-9, is a chemical compound that belongs to the class of phenoxyacetic acids. It is characterized by the presence of a phenoxy group, which is a phenyl ring bonded to an ether oxygen, and an acetic acid moiety. The compound features a chlorine atom and a methyl group on the phenyl ring, which contribute to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents. This compound is primarily known for its use as a herbicide, particularly in agricultural applications, where it acts as a plant growth regulator. Its mode of action involves interfering with the growth processes of certain plants, making it effective in controlling unwanted vegetation. Safety and handling precautions are essential due to its potential environmental impact and toxicity to non-target organisms. As with many chemical substances, proper storage and disposal methods should be followed to mitigate risks associated with its use.
Formula:C9H9ClO3
InChI:InChI=1/C9H9ClO3/c1-6-2-3-7(10)8(4-6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)
SMILES:Cc1ccc(c(c1)OCC(=O)O)Cl
Synonyms:
  • Acetic acid, (2-chloro-5-methylphenoxy)-
  • (2-Chloro-5-Methylphenoxy)Acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.