CymitQuimica logo

CAS 155602-48-5

:

5-Propyl-4-isoxazoleacetic acid

Description:
5-Propyl-4-isoxazoleacetic acid, with the CAS number 155602-48-5, is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique properties. This compound is known for its role as a selective agonist of the metabotropic glutamate receptor subtype 2 (mGluR2), making it of interest in neuropharmacology and potential therapeutic applications for neurological disorders. The presence of the propyl group enhances its lipophilicity, which can influence its bioavailability and interaction with biological membranes. Additionally, the isoxazole moiety is known for its stability and ability to participate in various chemical reactions, including potential modifications that can lead to derivatives with altered pharmacological profiles. The compound's solubility, melting point, and specific reactivity can vary based on environmental conditions and formulation. Overall, 5-Propyl-4-isoxazoleacetic acid represents a significant area of study in medicinal chemistry, particularly in the context of developing new treatments for conditions such as anxiety and depression.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c1-2-3-7-6(4-8(10)11)5-9-12-7/h5H,2-4H2,1H3,(H,10,11)
InChI key:InChIKey=HYQBSPGWFHBEDV-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(CCC)ON=C1
Synonyms:
  • 2-(5-Propyl-1,2-oxazol-4-yl)acetic acid
  • 2-(5-Propylisoxazol-4-yl)acetic acid
  • 4-Isoxazoleacetic acid, 5-propyl-
  • 5-Propyl-4-isoxazoleacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.