CAS 155613-94-8
:Aluminum, chloro[1,8,15,22-tetraphenoxy-29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]-, (SP-5-12)-
Description:
Aluminum chloro[1,8,15,22-tetraphenoxy-29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]-, commonly referred to as aluminum phthalocyanine, is a complex coordination compound featuring aluminum as the central metal ion coordinated to a phthalocyanine ligand. This substance exhibits a deep blue-green color, characteristic of phthalocyanine compounds, and is known for its stability and solubility in organic solvents. The presence of phenoxy groups enhances its solubility and may influence its electronic properties. Aluminum phthalocyanine is often utilized in various applications, including photodynamic therapy, where it acts as a photosensitizer, and in dye-sensitized solar cells due to its strong light-absorbing capabilities. Its structure allows for effective light absorption in the visible spectrum, making it valuable in photonic applications. Additionally, the chloro substituent may play a role in its reactivity and interaction with other chemical species. Overall, this compound is significant in both industrial and medical fields due to its unique properties and functionalities.
Formula:C56H32AlClN8O4
InChI:InChI=1S/C56H32N8O4.Al.ClH/c1-5-17-33(18-6-1)65-41-29-13-25-37-45(41)53-57-49(37)62-54-47-39(27-15-31-43(47)67-35-21-9-3-10-22-35)51(59-54)64-56-48-40(28-16-32-44(48)68-36-23-11-4-12-24-36)52(60-56)63-55-46-38(50(58-55)61-53)26-14-30-42(46)66-34-19-7-2-8-20-34;;/h1-32H;;1H/q-2;+3;/p-1
InChI key:InChIKey=UWEWHPDBQHLHSQ-UHFFFAOYSA-M
SMILES:[Cl-][Al+3]123[N-]4C=5C=6C(C4=NC7=[N]1C(=NC=8[N-]2C(=C9C8C(OC%10=CC=CC=C%10)=CC=C9)N=C%11[N]3=C(N5)C=%12C%11=C(OC%13=CC=CC=C%13)C=CC%12)C=%14C7=C(OC%15=CC=CC=C%15)C=CC%14)=CC=CC6OC%16=CC=CC=C%16
Synonyms:- Aluminum, chloro[1,8,15,22-tetraphenoxy-29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]-, (SP-5-12)-
- Aluminum, chloro[1,8,15,22-tetraphenoxy-29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]-, (SP-5-12)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
