CAS 155614-08-7
:4-methyl-2-phenyl-1-benzopyrylium tetra-fluorobor
Description:
4-Methyl-2-phenyl-1-benzopyrylium tetrafluoroborate is an organic compound characterized by its unique structure, which includes a benzopyrylium core. This compound features a methyl group and a phenyl group attached to the benzopyrylium ring, contributing to its distinct chemical properties. The tetrafluoroborate anion, derived from tetrafluoroboric acid, serves as a counterion, enhancing the compound's stability and solubility in various solvents. Typically, compounds of this nature exhibit strong absorption in the ultraviolet-visible spectrum, making them useful in photochemical applications. Additionally, they may display interesting fluorescence properties, which can be exploited in dye applications or as probes in biochemical assays. The presence of the tetrafluoroborate ion also suggests potential ionic interactions, which can influence the compound's reactivity and behavior in different chemical environments. Overall, 4-methyl-2-phenyl-1-benzopyrylium tetrafluoroborate is notable for its structural features and potential applications in materials science and organic chemistry.
Formula:C16H13BF4O
InChI:InChI=1/C16H13O.BF4/c1-12-11-16(13-7-3-2-4-8-13)17-15-10-6-5-9-14(12)15;2-1(3,4)5/h2-11H,1H3;/q+1;-1
Synonyms:- 4-Methyl-2-phenyl-1-benzopyrylium tetrafluoroborate
- 4-Methyl-2-Phenylchromenium Tetrafluoroborate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Benzopyrylium, 4-methyl-2-phenyl-, tetrafluoroborate(1-) (1:1)
CAS:Formula:C16H13BF4OMolecular weight:308.0784

