CAS 155618-38-5

1,3-Naphthalenedisulfonic acid, 5,6-diamino-, sodium salt (1:2)

Description:

1,3-Naphthalenedisulfonic acid, 5,6-diamino-, sodium salt (1:2) is an organic compound characterized by its naphthalene backbone with two sulfonic acid groups and two amino groups. This compound is typically used in various applications, including dye manufacturing and as a reagent in organic synthesis. The presence of sulfonic acid groups imparts high water solubility, making it suitable for use in aqueous solutions. The amino groups can participate in further chemical reactions, allowing for the formation of various derivatives. As a sodium salt, it is often more stable and easier to handle than its acid form. The compound is generally considered to be a stable solid at room temperature, with potential applications in the textile and pharmaceutical industries. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, its unique structure and functional groups contribute to its utility in diverse chemical processes.

Formula: C₁₀H₈N₂Na₂O₆S₂

InChI: InChI=1/C10H10N2O6S2.2Na/c11-8-2-1-6-7(10(8)12)3-5(19(13,14)15)4-9(6)20(16,17)18;;/h1-4H,11-12H2,(H,13,14,15)(H,16,17,18);;/q;2*+1/p-2

SMILES: c1cc(c(c2cc(cc(c12)S(=O)(=O)O)S(=O)(=O)O)N)N.[Na].[Na]

Synonyms:

• Disodium 5,6-diamino-1,3-naphthalenedisulfonate