CAS 15564-30-4
:1-Ethynyl-2-methylcyclohexanol
Description:
1-Ethynyl-2-methylcyclohexanol, with the CAS number 15564-30-4, is an organic compound characterized by its cyclohexanol structure modified with an ethynyl group and a methyl substituent. This compound features a cyclohexane ring, which is a saturated six-membered carbon ring, and the presence of the hydroxyl (-OH) group indicates that it is an alcohol. The ethynyl group, which is a triple-bonded carbon fragment, contributes to the compound's reactivity and potential applications in organic synthesis. The methyl group attached to the cyclohexanol ring influences the compound's steric and electronic properties, affecting its boiling point, solubility, and reactivity. Generally, compounds like 1-Ethynyl-2-methylcyclohexanol can be utilized in various chemical reactions, including those involving nucleophilic substitutions or as intermediates in the synthesis of more complex molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups.
Formula:C9H14O
InChI:InChI=1/C9H14O/c1-3-9(10)7-5-4-6-8(9)2/h1,8,10H,4-7H2,2H3
InChI key:InChIKey=PMCQAVDMFZFUEH-UHFFFAOYSA-N
SMILES:C(#C)C1(O)C(C)CCCC1
Synonyms:- 1-Ethynyl-2-methylcyclohexanol
- NSC 37636
- 1-Ethynyl-2-methylcyclohexan-1-ol
- 1-Ethynyl-2-methylcyclohexanol
- AI3-17968
- Cyclohexanol, 1-ethynyl-2-methyl-
- NSC 37636
- 2-Methyl-1-ethynylcyclohexan-1-ol
- 1-ETHYNYL-2-METHYL-CYCLOHEXANOL
- 1-Ethynyl-2-methyl-1-cyclohexanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
