CymitQuimica logo

CAS 155694-83-0

:

Benzoic acid, 2-bromo-3-methyl-, ethyl ester

Description:
Benzoic acid, 2-bromo-3-methyl-, ethyl ester, with the CAS number 155694-83-0, is an organic compound that belongs to the class of benzoic acid esters. It features a benzoic acid moiety substituted with a bromine atom at the 2-position and a methyl group at the 3-position, along with an ethyl ester functional group. This compound is typically characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the bromine atom introduces halogen reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions. The ethyl ester group enhances its solubility in organic solvents, making it suitable for applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific physical properties such as a distinct melting point and boiling point, which are influenced by its molecular structure and substituents. Overall, this compound is of interest in both academic research and industrial applications due to its unique chemical characteristics.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-3-13-10(12)8-6-4-5-7(2)9(8)11/h4-6H,3H2,1-2H3
InChI key:InChIKey=JLUNFGZPWZBSLB-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Br)C(C)=CC=C1
Synonyms:
  • Benzoic Acid, 2-Bromo-3-Methyl-, Ethyl Ester
  • Ethyl 2-bromo-3-methylbenzoate
  • Ethyl 2-bromo-3-methylbenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.