CAS 15572-30-2
:6-Bromo-2-naphthalenyl β-D-galactopyranoside
Description:
6-Bromo-2-naphthalenyl β-D-galactopyranoside is a chemical compound characterized by its structure, which includes a naphthalene moiety substituted with a bromine atom and a β-D-galactopyranoside unit. This compound is typically used in biochemical research, particularly in studies involving glycosylation and enzyme activity, as it can serve as a substrate for various glycosidases. The presence of the bromine atom enhances its reactivity and can influence its solubility and interaction with biological systems. The β-D-galactopyranoside portion is a sugar derivative, which contributes to its role in biological processes, particularly in cell signaling and recognition. The compound is generally soluble in organic solvents and may exhibit specific optical properties due to the naphthalene ring. Its applications may extend to the development of glycosylated compounds in medicinal chemistry and the study of carbohydrate-protein interactions. As with many chemical substances, safety precautions should be observed when handling this compound, given its potential biological activity.
Formula:C16H17BrO6
InChI:InChI=1S/C16H17BrO6/c17-10-3-1-9-6-11(4-2-8(9)5-10)22-16-15(21)14(20)13(19)12(7-18)23-16/h1-6,12-16,18-21H,7H2/t12-,13+,14+,15-,16-/m1/s1
InChI key:InChIKey=NLRXQZJJCPRATR-LYYZXLFJSA-N
SMILES:O(C1=CC2=C(C=C1)C=C(Br)C=C2)[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O
Synonyms:- .beta.-D-Galactopyranoside, 6-bromo-2-naphthalenyl
- 239-628-7
- 6-Bromo-2-Naphthyl-Beta-D-Galactopyranoside
- 6-Bromo-2-naphthalenyl β-<span class="text-smallcaps">D</span>-galactopyranoside
- 6-Bromo-2-naphthyl-β-<span class="text-smallcaps">D</span>-galactoside
- 6-bromonaphthalen-2-yl beta-D-galactopyranoside
- Galactopyranoside, 6-bromo-2-naphthyl, β-<span class="text-smallcaps">D</span>-
- β-<span class="text-smallcaps">D</span>-Galactopyranoside, 6-bromo-2-naphthalenyl
- Galactopyranoside, 6-bromo-2-naphthyl, β-D-
- 6-Bromo-2-naphthyl-b-D-galactopyranoside
- 6-Bromo-2-naphthalenyl β-D-galactopyranoside
- 6-Bromo-2-naphthyl-β-D-galactoside
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
β-D-Galactopyranoside, 6-bromo-2-naphthalenyl
CAS:Formula:C16H17BrO6Purity:95%Color and Shape:SolidMolecular weight:385.20666-Bromo-2-naphthyl-β-D-galactopyranoside
CAS:6-Bromo-2-naphthyl-β-D-galactopyranosideColor and Shape:PowderMolecular weight:385.21g/mol6-Bromo-2-naphthyl β-D-galactopyranoside
CAS:6-Bromo-2-naphthyl β-D-galactopyranoside is a chromogenic substrate commonly used for the detection of the enzymatic activity of β-galactosidase. It can produce a yellow precipitate upon hydrolysis by β-galactosidase, indicating the presence of the enzyme. It is often used in molecular biology applications to detect gene expression or to monitor cloning efficiency.Formula:C16H17BrO6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:385.21 g/mol6-Bromo-2-Naphthyl-ß-D-Galactopyranoside extrapure, 98%
CAS:Formula:C16H17BrO6Molecular weight:385.22




