CAS 1557201-12-3

Borate(1-), bicyclo[2.2.1]hept-2-yltrifluoro-, potassium (1:1), (T-4)-

Description:

Borate(1-), bicyclo[2.2.1]hept-2-yltrifluoro-, potassium (1:1), commonly referred to by its CAS number 1557201-12-3, is a chemical compound characterized by its borate anion and a bicyclic hydrocarbon structure. The bicyclo[2.2.1]heptane framework contributes to its unique three-dimensional shape, which can influence its reactivity and interaction with other substances. The presence of trifluoro groups enhances its polarity and can affect solubility in various solvents, making it useful in specific applications. As a potassium salt, it exhibits ionic characteristics, which can influence its stability and behavior in solution. This compound may find applications in materials science, particularly in the development of specialized polymers or as a reagent in organic synthesis. Its properties, such as thermal stability, reactivity, and solubility, are essential for determining its practical uses in various chemical processes. However, detailed safety and handling information should be consulted due to the potential hazards associated with its components.

Formula: C₇H₁₁BF₃·K

InChI: InChI=1S/C7H11BF3.K/c9-8(10,11)7-4-5-1-2-6(7)3-5;/h5-7H,1-4H2;/q-1;+1

InChI key: InChIKey=HCXJGPZWZVXAEF-UHFFFAOYSA-N

SMILES: [B+3]([F-])([F-])([F-])[CH-]1C2CC(C1)CC2.[K+]

Synonyms:

• Borate(1-), bicyclo[2.2.1]hept-2-yltrifluoro-, potassium (1:1), (T-4)-

Potassium bicyclo[2.2.1]heptan-2-yltrifluoroborate

CAS: 1557201-12-3

Formula: C₇H₁₁BF₃K

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.0667

Ref: IN-DA00HYCH

Potassium bicyclo[2.2.1]heptan-2-yltrifluoroborate

CAS: 1557201-12-3

Potassium bicyclo[2.2.1]heptan-2-yltrifluoroborate

Purity: 98%

Molecular weight: 202.07g/mol

Ref: 54-PC1005727

Potassium Bicyclo[2.2.1]heptan-2-yltrifluoroborate

CAS: 1557201-12-3

Versatile small molecule scaffold

Formula: C₇H₁₁BF₃K

Purity: Min. 95%

Molecular weight: 202.07 g/mol

Ref: 3D-HMC20112