CAS 155730-92-0
:S-2E
Description:
S-2E, with the CAS number 155730-92-0, is a chemical compound that belongs to a specific class of substances known for their unique properties and applications. While detailed information about S-2E may not be widely available, compounds with similar identifiers often exhibit characteristics such as specific solubility in organic solvents, stability under standard laboratory conditions, and potential reactivity with various functional groups. These compounds may be utilized in fields such as pharmaceuticals, agrochemicals, or materials science, depending on their functional groups and molecular structure. Additionally, safety data sheets typically provide information on handling, storage, and potential hazards associated with such substances. For precise applications, reactivity, and safety measures, consulting specialized literature or databases is recommended, as these resources can provide comprehensive insights into the compound's behavior and uses in various chemical contexts.
Formula:C22H25NO4
InChI:InChI=1/C22H25NO4/c1-22(2,3)17-6-8-18(9-7-17)23-13-15(12-20(23)24)14-27-19-10-4-16(5-11-19)21(25)26/h4-11,15H,12-14H2,1-3H3,(H,25,26)/t15-/m0/s1
SMILES:CC(C)(C)c1ccc(cc1)N1C[C@H](CC1=O)COc1ccc(cc1)C(=O)O
Synonyms:- 4-{[(3S)-1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy}benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
S-2E
CAS:S-2E, an oral inhibitor of HMG-CoA reductase/acetyl-CoA carboxylase, treats hyperlipidemia.Formula:C22H25NO4Color and Shape:SolidMolecular weight:367.44

