CAS 155731-15-0

5-Chloro-2-[[(1,1-dimethylethyl)amino]sulfonyl]-3-thiophenecarboxylic acid

Description:

5-Chloro-2-[[(1,1-dimethylethyl)amino]sulfonyl]-3-thiophenecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring, a carboxylic acid group, and a sulfonamide functional group. The presence of a chlorine atom at the 5-position of the thiophene ring contributes to its reactivity and potential biological activity. The compound also features a tert-butyl group attached to an amino group, which enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its sulfonamide moiety is known for its role in various therapeutic agents, including antibiotics and diuretics. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₉H₁₂ClNO₄S₂

InChI: InChI=1S/C9H12ClNO4S2/c1-9(2,3)11-17(14,15)8-5(7(12)13)4-6(10)16-8/h4,11H,1-3H3,(H,12,13)

InChI key: InChIKey=AAGPMZWZIZWWFA-UHFFFAOYSA-N

SMILES: S(NC(C)(C)C)(=O)(=O)C1=C(C(O)=O)C=C(Cl)S1

Synonyms:

• 3-Thiophenecarboxylic acid, 5-chloro-2-[[(1,1-dimethylethyl)amino]sulfonyl]-
• 2-(tert-Butylsulfamoyl)-5-chlorothiophene-3-carboxylic acid
• 5-Chloro-2-[[(1,1-dimethylethyl)amino]sulfonyl]-3-thiophenecarboxylic acid

2-(tert-Butylsulfamoyl)-5-chlorothiophene-3-carboxylic acid

CAS: 155731-15-0

Versatile small molecule scaffold

Formula: C₉H₁₂ClNO₄S₂

Purity: Min. 95%

Molecular weight: 297.8 g/mol

Ref: 3D-FGA73115