CymitQuimica logo

CAS 155766-33-9

:

(+/-)-TRANS-1-ALLYL-2 5-DIMETHYLPIPERAZ&

Description:
(+/-)-TRANS-1-ALLYL-2,5-DIMETHYLPIPERAZINE, with the CAS number 155766-33-9, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms. The presence of allyl and dimethyl groups contributes to its unique structural and chemical properties. The term "trans" indicates the specific geometric configuration of the substituents around the piperazine ring, which can influence its biological activity and interactions. This compound may exhibit chiral characteristics, as indicated by the "(+/-)" notation, suggesting the existence of both enantiomers. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other biological pathways. Additionally, the presence of multiple functional groups can affect its solubility, reactivity, and overall stability, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C9H18N2
InChI:InChI=1/C9H18N2/c1-4-5-11-7-8(2)10-6-9(11)3/h4,8-10H,1,5-7H2,2-3H3/t8-,9+/m1/s1
Synonyms:
  • Piperazine, 2,5-dimethyl-1-(2-propenyl)-, (2R,5S)-rel- (9CI)
  • (2R,5S)-2,5-dimethyl-1-(prop-2-en-1-yl)piperazine
  • (2S,5R)-2,5-dimethyl-1-(prop-2-en-1-yl)piperazine
  • (+/-)-TRANS-1-ALLYL-2 5-DIMETHYLPIPERAZ&
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.