CAS 15578-73-1
:2-(piperidin-2-yl)pyridine
Description:
2-(Piperidin-2-yl)pyridine, with the CAS number 15578-73-1, is a chemical compound characterized by its pyridine ring substituted with a piperidine group. This compound typically exhibits a heterocyclic structure, which contributes to its potential biological activity. The presence of both nitrogen-containing rings can influence its solubility, polarity, and reactivity. It is often studied for its pharmacological properties, particularly in medicinal chemistry, where it may serve as a scaffold for developing various therapeutic agents. The compound may exhibit basic properties due to the nitrogen atoms, allowing it to participate in hydrogen bonding and interact with biological targets. Additionally, its structural features may lead to specific interactions with receptors or enzymes, making it of interest in drug discovery. Overall, 2-(piperidin-2-yl)pyridine is a versatile compound with potential applications in pharmaceuticals and research, owing to its unique chemical characteristics.
Formula:C10H14N2
InChI:InChI=1/C10H14N2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1,3,5,7,10,12H,2,4,6,8H2
SMILES:c1ccnc(c1)C1CCCCN1
Synonyms:- (-)-2-(3'-Pyridyl)piperidine
- Pyridine, 2-(2-Piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
