
CAS 1557852-04-6
:5-Methyl-5-(2-pyridinyl)-2-piperazinone
Description:
5-Methyl-5-(2-pyridinyl)-2-piperazinone is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a methyl group at the 5-position and a pyridine ring at the 5-position of the piperazinone structure contributes to its unique properties. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen in its ring structure. It may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could lead to pharmacological applications. Additionally, its solubility and stability in different solvents can vary, influencing its behavior in chemical reactions and biological systems. As with many piperazine derivatives, it may also possess properties such as basicity due to the nitrogen atoms, which can participate in hydrogen bonding and coordination with other molecules. Overall, 5-Methyl-5-(2-pyridinyl)-2-piperazinone represents a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-10(7-12-9(14)6-13-10)8-4-2-3-5-11-8/h2-5,13H,6-7H2,1H3,(H,12,14)
InChI key:InChIKey=XUSPQELEBPUBOX-UHFFFAOYSA-N
SMILES:CC1(CNC(=O)CN1)C2=CC=CC=N2
Synonyms:- 2-Piperazinone, 5-methyl-5-(2-pyridinyl)-
- 5-Methyl-5-(2-pyridinyl)-2-piperazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.