CymitQuimica logo

CAS 155789-92-7

:

3-Methoxy-2-Nitro-4-Picoline

Description:
3-Methoxy-2-Nitro-4-Picoline, with the CAS number 155789-92-7, is an organic compound that belongs to the class of nitro-substituted pyridines. It features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound is characterized by the presence of a methoxy group (-OCH3) and a nitro group (-NO2) at specific positions on the pyridine ring, which influence its chemical reactivity and physical properties. Typically, such compounds exhibit moderate to high polarity due to the electronegative substituents, which can affect their solubility in various solvents. 3-Methoxy-2-Nitro-4-Picoline may also display biological activity, making it of interest in pharmaceutical research. Its synthesis often involves nitration and methoxylation reactions, and it can be analyzed using techniques such as NMR and mass spectrometry. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous.
Formula:C7H8N2O3
InChI:InChI=1/C7H8N2O3/c1-5-3-4-8-7(9(10)11)6(5)12-2/h3-4H,1-2H3
SMILES:Cc1ccnc(c1OC)N(=O)=O
Synonyms:
  • 3-Methoxy-4-Methyl-2-Nitropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.