CAS 15579-00-7
:3-[(2-AMINOETHYL)DITHIO]PROPIONIC ACID
Description:
3-[(2-Aminoethyl)dithio]propionic acid, with the CAS number 15579-00-7, is an organic compound characterized by the presence of both amino and dithio functional groups. This compound features a propionic acid backbone, which contributes to its acidic properties. The aminoethyl group introduces basic characteristics, allowing for potential interactions in biological systems. The dithio moiety, consisting of two sulfur atoms, imparts unique reactivity and the ability to form disulfide bonds, which can be significant in biochemical processes, particularly in protein structure and stability. This compound is often studied for its potential applications in biochemistry and medicinal chemistry, particularly in the context of peptide synthesis and as a reducing agent. Its solubility in water and organic solvents can vary, influencing its utility in various chemical reactions. Overall, 3-[(2-aminoethyl)dithio]propionic acid is notable for its dual functionality, making it a valuable compound in both synthetic and biological chemistry.
Formula:C5H11NO2S2
InChI:InChI=1/C5H11NO2S2/c6-2-4-10-9-3-1-5(7)8/h1-4,6H2,(H,7,8)
SMILES:C(CSSCCN)C(=O)O
Synonyms:- 3-[(2-Aminoethyl)Disulfanyl]Propanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Propanoic acid, 3-[(2-aminoethyl)dithio]-
CAS:Formula:C5H11NO2S2Purity:95%Color and Shape:SolidMolecular weight:181.27633-((2-Aminoethyl)Disulfanyl)Propanoic Acid
CAS:3-((2-Aminoethyl)Disulfanyl)Propanoic AcidPurity:98%Molecular weight:181.28g/molAminoethyl-SS-propionic acid
CAS:Aminoethyl-SS-propionic acid: cleavable ADC linker for targeted drug delivery via antibody-drug conjugates.Formula:C5H11NO2S2Purity:98%Color and Shape:White SolidMolecular weight:181.283-[(2-Aminoethyl)dithio]propionic Acid
CAS:Controlled ProductStability Hygroscopic
Applications A useful reversible immobilization or crosslinking reagent.
References Pandurangi, R., et al.: Bioorg. Chem., 26, 201 (1998), Kim, H., et al.: J. Agric. Food Chem., 55, 3750 (2007),Formula:C5H11NO2S2Color and Shape:Off White PowderMolecular weight:181.283-[(2-Aminoethyl)dithio]propionic acid
CAS:Dithiobis(3-mercaptopropionate) is an analog of 3-[(2-Aminoethyl)dithio]propionic acid (DTA). It has been used as a cross-linking agent for the synthesis of polymers with acidic pH. Dithiobis(3-mercaptopropionate) is also used for the synthesis of conjugates and bifunctional molecules. Dithiobis(3-mercaptopropionate) can be synthesized by reacting bis(sulfanylmethyl)amine with sodium azide in an acidic solution. The cross-linking reaction will produce a disulfide bond, which is a covalent linkage between two cysteine residues in two different polypeptides or proteins. This crosslink is irreversible, so it cannot be broken down by chemical processes, but can be broken down by enzymatic digestion.Formula:C5H11NO2S2Purity:(%) Min. 95%Color and Shape:PowderMolecular weight:181.28 g/mol





