CAS 15579-82-5

5-Pyrimidinamine, 4-methoxy- (9CI)

Description:

5-Pyrimidinamine, 4-methoxy- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features an amino group (-NH2) at the 5-position and a methoxy group (-OCH3) at the 4-position of the pyrimidine ring, contributing to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and methoxy functional groups. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₇N₃O

InChI: InChI=1/C5H7N3O/c1-9-5-4(6)2-7-3-8-5/h2-3H,6H2,1H3

SMILES: COc1c(cncn1)N

Synonyms:

• 4-Methoxypyrimidin-5-amine

5-Pyrimidinamine, 4-methoxy-

CAS: 15579-82-5

Formula: C₅H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.1286

Ref: IN-DA001O6V

5-Amino-4-methoxypyrimidine

CAS: 15579-82-5

5-Amino-4-methoxypyrimidine

Purity: ≥95%

Molecular weight: 125.13g/mol

Ref: 54-OR30754

4-Methoxypyrimidin-5-amine

CAS: 15579-82-5

Formula: C₅H₇N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 125.131

Ref: 10-F240075

4-methoxypyrimidin-5-amine

CAS: 15579-82-5

Versatile small molecule scaffold

Formula: C₅H₇N₃O

Purity: Min. 95%

Molecular weight: 125.12 g/mol

Ref: 3D-QAA57982