CymitQuimica logo

CAS 1558-17-4

:

4,6-Dimethylpyrimidine

Description:
4,6-Dimethylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring with two methyl groups attached at the 4 and 6 positions. It has a molecular formula of C7H8N2 and a molecular weight of approximately 136.15 g/mol. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. 4,6-Dimethylpyrimidine is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It exhibits basic properties due to the presence of nitrogen atoms in the ring, which can participate in protonation reactions. Additionally, it can undergo various chemical transformations, including alkylation and acylation, making it a versatile building block in organic synthesis. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes.
Formula:C6H8N2
InChI:InChI=1S/C6H8N2/c1-5-3-6(2)8-4-7-5/h3-4H,1-2H3
InChI key:InChIKey=LSBIUXKNVUBKRI-UHFFFAOYSA-N
SMILES:CC=1C=C(C)N=CN1
Synonyms:
  • Dimethylpyrimidinetech
  • NSC 60686
  • Pyrimidine, 4,6-dimethyl-
  • 4,6-Dimethylpyrimidine
Found 5 products.