CAS 1558-23-2: 3,6-dimethyl-1,2,4,5-tetrazine

Description:3,6-Dimethyl-1,2,4,5-tetrazine is a heterocyclic organic compound characterized by a six-membered ring containing four nitrogen atoms and two carbon atoms. This compound features two methyl groups attached to the 3 and 6 positions of the tetrazine ring, which influences its chemical reactivity and stability. It is known for its potential applications in the field of energetic materials, particularly as a precursor or component in propellants and explosives due to its high nitrogen content and ability to release energy upon decomposition. The presence of multiple nitrogen atoms contributes to its energetic properties, making it a subject of interest in both academic and industrial research. Additionally, 3,6-dimethyl-1,2,4,5-tetrazine exhibits properties typical of tetrazines, such as being relatively stable under standard conditions but reactive under specific circumstances, particularly when subjected to heat or shock. Its unique structure and reactivity profile make it a valuable compound in the study of nitrogen-rich materials and their applications in various fields.

Formula:C₄H₆N₄

InChI:InChI=1S/C4H6N4/c1-3-5-7-4(2)8-6-3/h1-2H3

InChI key:InChIKey=DGLYTMLIGRQDPE-UHFFFAOYSA-N

SMILES:N=1N=C(N=NC1C)C

Synonyms:
1,2,4,5-Tetrazine, 3,6-dimethyl-
3,6-Dimethyl s-tetrazine
Dimethyl-s-tetrazine
Dimethyltetrazine
s-Tetrazine, 3,6-dimethyl-
s-Tetrazine, dimethyl-
3,6-Dimethyl-1,2,4,5-tetrazine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3,6-Dimethyl-1,2,4,5-tetrazine REF: 3B-D5733CAS: 1558-23-2	>98.0%(GC)	63.00 €~185.00 €	Wed 19 Mar 25
Dimethyl-1,2,4,5-tetrazine REF: IN-DA00B044CAS: 1558-23-2	98.0%	70.00 €~539.00 €	Wed 26 Mar 25
3,6-Dimethyl-1,2,4,5-Tetrazine REF: 54-OR1010839CAS: 1558-23-2	97%	149.00 €~590.00 €	Thu 27 Mar 25
3,6-Dimethyl-1,2,4,5-tetrazine REF: 3D-BAA55823CAS: 1558-23-2	Min. 95%	- - -	Discontinued product