CAS 15581-80-3
:2,2'-disulfanediylbis(2-methylpropanal)
Description:
2,2'-Disulfanediylbis(2-methylpropanal), with the CAS number 15581-80-3, is an organic compound characterized by the presence of two aldehyde functional groups and a disulfide linkage. This compound features a symmetrical structure where two 2-methylpropanal moieties are connected by a disulfide bond (–S–S–). The aldehyde groups contribute to its reactivity, making it susceptible to oxidation and reduction reactions. The presence of the disulfide bond imparts unique properties, such as the ability to form cross-links in polymeric materials or participate in redox reactions. Additionally, the branched alkyl groups provide steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This compound may have applications in organic synthesis, particularly in the development of new materials or as intermediates in chemical reactions. However, specific safety and handling information should be consulted, as compounds with disulfide linkages can exhibit varying degrees of toxicity and reactivity.
Formula:C8H14O2S2
InChI:InChI=1/C8H14O2S2/c1-7(2,5-9)11-12-8(3,4)6-10/h5-6H,1-4H3
SMILES:CC(C)(C=O)SSC(C)(C)C=O
Synonyms:- Propanal, 2,2'-Dithiobis[2-Methyl-
- 2,2'-Disulfanediylbis(2-methylpropanal)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.