CymitQuimica logo

CAS 1558142-01-0

:

4-(3-Oxopropyl)-1-piperazinecarboxamide

Description:
4-(3-Oxopropyl)-1-piperazinecarboxamide is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential solubility in polar solvents. The presence of a 3-oxopropyl substituent indicates that it has a ketone functional group, which can influence its reactivity and interactions with biological targets. The molecular structure suggests that it may exhibit properties such as moderate polarity and potential hydrogen bonding capabilities, making it of interest in medicinal chemistry. Compounds with similar structures are often investigated for their pharmacological activities, including potential roles as therapeutic agents. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or detailed literature review for precise values. Overall, this compound's unique structural features may contribute to its biological activity and utility in various chemical applications.
Formula:C8H15N3O2
InChI:InChI=1S/C8H15N3O2/c9-8(13)11-5-3-10(4-6-11)2-1-7-12/h7H,1-6H2,(H2,9,13)
InChI key:InChIKey=YSKPLRSMZUEQLD-UHFFFAOYSA-N
SMILES:C(N)(=O)N1CCN(CCC=O)CC1
Synonyms:
  • 1-Piperazinecarboxamide, 4-(3-oxopropyl)-
  • 4-(3-Oxopropyl)-1-piperazinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.