
CAS 15585-86-1
:2-(Dimethylamino)ethyl cyclohexanepropanoate
Description:
2-(Dimethylamino)ethyl cyclohexanepropanoate, with the CAS number 15585-86-1, is an organic compound characterized by its ester functional group, which is derived from cyclohexanepropanoic acid and dimethylaminoethanol. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in polar solvents, such as water and alcohols, due to the presence of the dimethylamino group. The dimethylamino moiety contributes to its basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the cyclohexane ring provides a hydrophobic character, influencing its interaction with biological membranes. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drug formulations. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H25NO2
InChI:InChI=1S/C13H25NO2/c1-14(2)10-11-16-13(15)9-8-12-6-4-3-5-7-12/h12H,3-11H2,1-2H3
InChI key:InChIKey=MPOYJPINNSIHAK-UHFFFAOYSA-N
SMILES:C(CC(OCCN(C)C)=O)C1CCCCC1
Synonyms:- Cyclohexanepropanoic acid, 2-(dimethylamino)ethyl ester
- Cyprodenate
- 2-(Dimethylamino)ethyl cyclohexanepropanoate
- Cyclohexanepropionic acid, 2-(dimethylamino)ethyl ester
- 2-(Dimethylamino)ethyl cyclohexanepropionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cyprodenate
CAS:<p>Cyprodenate (Actebral) is a potent orally active brain-activating agent with appetite-suppressing properties, useful in studying metabolic.</p>Formula:C13H25NO2Color and Shape:SolidMolecular weight:227.34


