CAS 155861-51-1

9,10-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one

Description:

9,10-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one is a complex organic compound characterized by its unique fused ring structure, which incorporates both indole and naphthyridine moieties. This compound features two methoxy groups (-OCH3) that enhance its solubility and reactivity. The presence of the carbonyl group (C=O) in the naphthyridine portion contributes to its potential as a bioactive molecule, possibly influencing its interaction with biological targets. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its heterocyclic nature, which is often associated with various biological activities. Additionally, the specific arrangement of atoms and functional groups may impart unique optical and electronic properties, making it of interest in materials science and organic electronics. Overall, 9,10-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one represents a fascinating subject for further research in both synthetic and applied chemistry.

Formula: C₁₆H₁₂N₂O₃

InChI: InChI=1S/C16H12N2O3/c1-20-13-7-10-9-5-6-17-11-3-4-15(19)18(16(9)11)12(10)8-14(13)21-2/h3-8H,1-2H3

InChI key: InChIKey=VKMIBFAQYHUWCU-UHFFFAOYSA-N

SMILES: O=C1N2C=3C(C=4C2=CC(OC)=C(OC)C4)=CC=NC3C=C1

Synonyms:

• 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 9,10-dimethoxy-
• 9,10-Dimethoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
• 9,10-Dimethoxycanthin-6-one
• 10-Dimethoxycanthin-6-one

9,10-Dimethoxycanthin-6-one

CAS: 155861-51-1

9,10-Dimethoxycanthin-6-one shows cytotoxic activity against a HT-1080 human fibrosarcoma cell line( IC50 = 5.0 microM).

Formula: C₁₆H₁₂N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 280.28

Ref: TM-TN3307

9,10-Dimethoxycanthin-6-one

CAS: 155861-51-1

9,10-Dimethoxycanthin-6-one is a natural alkaloid, which is derived from various plant sources, particularly those belonging to the Simaroubaceae family. This compound displays an intriguing mode of action, primarily involving the inhibition of enzymatic pathways and interference with cellular DNA processes. Its biochemical activities suggest potential applications in medical and pharmacological research.

Formula: C₁₆H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 280.28 g/mol

Ref: 3D-FGA86151