CAS 155877-06-8

Diazenedicarboxamide, tetrakis(1-methylethyl)-

Description:

Diazenedicarboxamide, tetrakis(1-methylethyl)-, also known by its CAS number 155877-06-8, is a chemical compound characterized by its structure, which includes two carboxamide groups and four isopropyl groups attached to a diazene backbone. This compound typically appears as a white to off-white solid and is known for its stability under normal conditions. It is often utilized in various applications, including as a blowing agent in the production of foamed plastics and rubber. The presence of the isopropyl groups contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. Additionally, the compound may exhibit thermal stability, which is advantageous in processing conditions. Safety data sheets should be consulted for handling and storage guidelines, as with many chemical substances, it may pose health risks if not managed properly. Overall, diazenedicarboxamide derivatives are of interest in materials science and industrial applications due to their unique chemical properties.

Formula: C₁₄H₂₈N₄O₂

InChI: InChI=1S/C14H28N4O2/c1-9(2)17(10(3)4)13(19)15-16-14(20)18(11(5)6)12(7)8/h9-12H,1-8H3

InChI key: InChIKey=NKMKDPVCESDJCN-UHFFFAOYSA-N

SMILES: N(C(N=NC(N(C(C)C)C(C)C)=O)=O)(C(C)C)C(C)C

Synonyms:

• Diazenedicarboxamide, tetrakis(1-methylethyl)-