CAS 15589-58-9
:N,N'-bis(4-methoxyphenyl)propanediamide
Description:
N,N'-bis(4-methoxyphenyl)propanediamide, with the CAS number 15589-58-9, is an organic compound characterized by its amide functional groups and aromatic methoxy-substituted phenyl rings. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the presence of the aromatic rings. The methoxy groups enhance its electron-donating properties, which can influence its reactivity and interactions with other molecules. It may display interesting thermal and chemical stability, making it suitable for various applications in organic synthesis and materials science. Additionally, the presence of multiple functional groups suggests potential for hydrogen bonding, which could affect its physical properties, such as melting point and solubility. Overall, N,N'-bis(4-methoxyphenyl)propanediamide is a versatile compound with potential utility in research and industrial applications, particularly in the development of pharmaceuticals and advanced materials.
Formula:C17H18N2O4
InChI:InChI=1/C17H18N2O4/c1-22-14-7-3-12(4-8-14)18-16(20)11-17(21)19-13-5-9-15(23-2)10-6-13/h3-10H,11H2,1-2H3,(H,18,20)(H,19,21)
SMILES:COc1ccc(cc1)NC(=O)CC(=O)Nc1ccc(cc1)OC
Synonyms:- N,N'-Bis(4-methoxyphenyl)malonamide
- propanediamide, N~1~,N~3~-bis(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.