CymitQuimica logo

CAS 155894-96-5

:

(S)-(+)-2-phenyl-N-(trifluoroacetyl)-glycine

Description:
(S)-(+)-2-phenyl-N-(trifluoroacetyl)-glycine, with the CAS number 155894-96-5, is an amino acid derivative characterized by its chiral center, which imparts specific optical activity. This compound features a phenyl group attached to the second carbon of the glycine backbone, enhancing its hydrophobic characteristics. The trifluoroacetyl group contributes to its stability and reactivity, making it useful in various chemical applications, including as a chiral auxiliary in asymmetric synthesis. The presence of the trifluoroacetyl moiety also increases the compound's lipophilicity, which can influence its interaction with biological systems. This substance is typically utilized in the synthesis of pharmaceuticals and in research settings to study chiral recognition and interactions. Its solid-state properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, (S)-(+)-2-phenyl-N-(trifluoroacetyl)-glycine is a significant compound in the field of medicinal chemistry and chiral synthesis.
Formula:C10H8F3NO3
InChI:InChI=1/C10H8F3NO3/c11-10(12,13)9(17)14-7(8(15)16)6-4-2-1-3-5-6/h1-5,7H,(H,14,17)(H,15,16)/t7-/m0/s1
SMILES:c1ccc(cc1)[C@@H](C(=O)O)N=C(C(F)(F)F)O
Synonyms:
  • (2S)-phenyl[(trifluoroacetyl)amino]ethanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.